C24H29FN2O2 — CID 123173930
(11E)-1-[4-fluoro-3-(2-iminopropanoyl)phenyl]-10-imino-4-methyl-9-methylidenetrideca-1,11-dien-3-one (PubChem CID 123173930) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is (11E)-1-[4-fluoro-3-(2-iminopropanoyl)phenyl]-10-imino-4-methyl-9-methylidenetrideca-1,11-dien-3-one.
| Compound Name | (11E)-1-[4-fluoro-3-(2-iminopropanoyl)phenyl]-10-imino-4-methyl-9-methylidenetrideca-1,11-dien-3-one |
|---|---|
| PubChem CID | 123173930 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (11E)-1-[4-fluoro-3-(2-iminopropanoyl)phenyl]-10-imino-4-methyl-9-methylidenetrideca-1,11-dien-3-one |
| SMILES | [H]/N=C(\C)C(=O)c1cc(C=CC(=O)C(C)CCCCC(=C)C(/C=C/C)=N/[H])ccc1F |
| InChI | InChI=1S/C24H29FN2O2/c1-5-8-22(27)16(2)9-6-7-10-17(3)23(28)14-12-19-11-13-21(25)20(15-19)24(29)18(4)26/h5,8,11-15,17,26-27H,2,6-7,9-10H2,1,3-4H3/b8-5+,14-12?,26-18+,27-22+ |
| InChIKey | UJKWIHIQMSXDSI-IWUMERGASA-N |
| XLogP | 5.98 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|