C23H30N2O3 — CID 123828728
5-[(1E,11E)-10-imino-5-methyl-9-methylidene-4-oxotrideca-1,11-dienyl]-2-methoxybenzamide (PubChem CID 123828728) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 5-[(1E,11E)-10-imino-5-methyl-9-methylidene-4-oxotrideca-1,11-dienyl]-2-methoxybenzamide.
| Compound Name | 5-[(1E,11E)-10-imino-5-methyl-9-methylidene-4-oxotrideca-1,11-dienyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 123828728 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 5-[(1E,11E)-10-imino-5-methyl-9-methylidene-4-oxotrideca-1,11-dienyl]-2-methoxybenzamide |
| SMILES | [H]/N=C(\C=C\C)C(=C)CCCC(C)C(=O)C/C=C/c1ccc(OC)c(C(N)=O)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-5-8-20(24)16(2)9-6-10-17(3)21(26)12-7-11-18-13-14-22(28-4)19(15-18)23(25)27/h5,7-8,11,13-15,17,24H,2,6,9-10,12H2,1,3-4H3,(H2,25,27)/b8-5+,11-7+,24-20+ |
| InChIKey | LTYDVNHBSHNFQZ-NTJGMUHESA-N |
| XLogP | 4.72 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|