C11H12ClNO2 — CID 170797760
4-(3-chloro-4-methoxyphenyl)but-3-enamide (PubChem CID 170797760) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)but-3-enamide.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)but-3-enamide |
|---|---|
| PubChem CID | 170797760 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)but-3-enamide |
| SMILES | COc1ccc(C=CCC(N)=O)cc1Cl |
| InChI | InChI=1S/C11H12ClNO2/c1-15-10-6-5-8(7-9(10)12)3-2-4-11(13)14/h2-3,5-7H,4H2,1H3,(H2,13,14) |
| InChIKey | VOSGLZRFBZODLV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |