C10H8Cl2FNO — CID 170797705
4-(3,5-dichloro-4-fluorophenyl)but-3-enamide (PubChem CID 170797705) has the molecular formula C10H8Cl2FNO and a molecular weight of 248.08 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-fluorophenyl)but-3-enamide.
| Compound Name | 4-(3,5-dichloro-4-fluorophenyl)but-3-enamide |
|---|---|
| PubChem CID | 170797705 |
| Molecular Formula | C10H8Cl2FNO |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 4-(3,5-dichloro-4-fluorophenyl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2FNO/c11-7-4-6(2-1-3-9(14)15)5-8(12)10(7)13/h1-2,4-5H,3H2,(H2,14,15) |
| InChIKey | UTHIEAHDZSERNH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|