C9H8Cl2N2O — CID 170798983
4-(2,6-dichloro-4-pyridinyl)but-3-enamide (PubChem CID 170798983) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-pyridinyl)but-3-enamide.
| Compound Name | 4-(2,6-dichloro-4-pyridinyl)but-3-enamide |
|---|---|
| PubChem CID | 170798983 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 4-(2,6-dichloro-4-pyridinyl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O/c10-7-4-6(5-8(11)13-7)2-1-3-9(12)14/h1-2,4-5H,3H2,(H2,12,14) |
| InChIKey | ITDIPWSLTSWLOC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|