C9H10Cl2N2 — CID 169474620
3-(2,6-dichloro-4-pyridinyl)-N-methylprop-2-en-1-amine (PubChem CID 169474620) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-pyridinyl)-N-methylprop-2-en-1-amine.
| Compound Name | 3-(2,6-dichloro-4-pyridinyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 169474620 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3-(2,6-dichloro-4-pyridinyl)-N-methylprop-2-en-1-amine |
| SMILES | CNCC=Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2/c1-12-4-2-3-7-5-8(10)13-9(11)6-7/h2-3,5-6,12H,4H2,1H3 |
| InChIKey | YIDVKVCIXPBKDS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|