C10H10Cl2N2O — CID 170797950
4-(2-amino-3,5-dichlorophenyl)but-3-enamide (PubChem CID 170797950) has the molecular formula C10H10Cl2N2O and a molecular weight of 245.11 g/mol. Its IUPAC name is 4-(2-amino-3,5-dichlorophenyl)but-3-enamide.
| Compound Name | 4-(2-amino-3,5-dichlorophenyl)but-3-enamide |
|---|---|
| PubChem CID | 170797950 |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 4-(2-amino-3,5-dichlorophenyl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C10H10Cl2N2O/c11-7-4-6(2-1-3-9(13)15)10(14)8(12)5-7/h1-2,4-5H,3,14H2,(H2,13,15) |
| InChIKey | ZPVSEZGOJSZOBD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|