C10H8F2N2O3 — CID 170798572
4-(3,5-difluoro-4-nitrophenyl)but-3-enamide (PubChem CID 170798572) has the molecular formula C10H8F2N2O3 and a molecular weight of 242.18 g/mol. Its IUPAC name is 4-(3,5-difluoro-4-nitrophenyl)but-3-enamide.
| Compound Name | 4-(3,5-difluoro-4-nitrophenyl)but-3-enamide |
|---|---|
| PubChem CID | 170798572 |
| Molecular Formula | C10H8F2N2O3 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-(3,5-difluoro-4-nitrophenyl)but-3-enamide |
| SMILES | NC(=O)CC=Cc1cc(F)c([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C10H8F2N2O3/c11-7-4-6(2-1-3-9(13)15)5-8(12)10(7)14(16)17/h1-2,4-5H,3H2,(H2,13,15) |
| InChIKey | VGCXXOWBBURIPQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|