C9H6ClF2NO2 — CID 169477951
5-(3-chloroprop-1-enyl)-1,3-difluoro-2-nitrobenzene (PubChem CID 169477951) has the molecular formula C9H6ClF2NO2 and a molecular weight of 233.60 g/mol. Its IUPAC name is 5-(3-chloroprop-1-enyl)-1,3-difluoro-2-nitrobenzene.
| Compound Name | 5-(3-chloroprop-1-enyl)-1,3-difluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 169477951 |
| Molecular Formula | C9H6ClF2NO2 |
| Molecular Weight | 233.60 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 5-(3-chloroprop-1-enyl)-1,3-difluoro-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)cc(C=CCCl)cc1F |
| InChI | InChI=1S/C9H6ClF2NO2/c10-3-1-2-6-4-7(11)9(13(14)15)8(12)5-6/h1-2,4-5H,3H2 |
| InChIKey | AGVNBTNYQWQHIA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|