C25H32N2O3 — CID 123809434
(1E,11E)-10-imino-1-[3-(2-iminopropanoyl)-4-methoxyphenyl]-5-methyl-9-methylidenetrideca-1,11-dien-4-one (PubChem CID 123809434) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (1E,11E)-10-imino-1-[3-(2-iminopropanoyl)-4-methoxyphenyl]-5-methyl-9-methylidenetrideca-1,11-dien-4-one.
| Compound Name | (1E,11E)-10-imino-1-[3-(2-iminopropanoyl)-4-methoxyphenyl]-5-methyl-9-methylidenetrideca-1,11-dien-4-one |
|---|---|
| PubChem CID | 123809434 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (1E,11E)-10-imino-1-[3-(2-iminopropanoyl)-4-methoxyphenyl]-5-methyl-9-methylidenetrideca-1,11-dien-4-one |
| SMILES | [H]/N=C(\C)C(=O)c1cc(/C=C/CC(=O)C(C)CCCC(=C)C(/C=C/C)=N/[H])ccc1OC |
| InChI | InChI=1S/C25H32N2O3/c1-6-9-22(27)17(2)10-7-11-18(3)23(28)13-8-12-20-14-15-24(30-5)21(16-20)25(29)19(4)26/h6,8-9,12,14-16,18,26-27H,2,7,10-11,13H2,1,3-5H3/b9-6+,12-8+,26-19+,27-22+ |
| InChIKey | CFABVCBZPLHWOS-TWINRNQRSA-N |
| XLogP | 5.85 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|