C14H15NO5 — CID 175374522
methyl 5-(3-acetamido-3-oxoprop-1-enyl)-2-methoxybenzoate (PubChem CID 175374522) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 5-(3-acetamido-3-oxoprop-1-enyl)-2-methoxybenzoate.
| Compound Name | methyl 5-(3-acetamido-3-oxoprop-1-enyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 175374522 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl 5-(3-acetamido-3-oxoprop-1-enyl)-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(C=CC(=O)NC(C)=O)ccc1OC |
| InChI | InChI=1S/C14H15NO5/c1-9(16)15-13(17)7-5-10-4-6-12(19-2)11(8-10)14(18)20-3/h4-8H,1-3H3,(H,15,16,17) |
| InChIKey | CPMDFLHQWMSKET-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|