C25H33N2O3+ — CID 123840894
ethylidene-[5-(10-imino-5-methyl-9-methylidene-4-oxododeca-2,11-dienyl)-2-methoxybenzoyl]-methylazanium (PubChem CID 123840894) has the molecular formula C25H33N2O3+ and a molecular weight of 409.55 g/mol. Its IUPAC name is ethylidene-[5-(10-imino-5-methyl-9-methylidene-4-oxododeca-2,11-dienyl)-2-methoxybenzoyl]-methylazanium.
| Compound Name | ethylidene-[5-(10-imino-5-methyl-9-methylidene-4-oxododeca-2,11-dienyl)-2-methoxybenzoyl]-methylazanium |
|---|---|
| PubChem CID | 123840894 |
| Molecular Formula | C25H33N2O3+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | ethylidene-[5-(10-imino-5-methyl-9-methylidene-4-oxododeca-2,11-dienyl)-2-methoxybenzoyl]-methylazanium |
| SMILES | [H]/N=C(\C=C)C(=C)CCCC(C)C(=O)C=CCc1ccc(OC)c(C(=O)/[N+](C)=C/C)c1 |
| InChI | InChI=1S/C25H33N2O3/c1-7-22(26)18(3)11-9-12-19(4)23(28)14-10-13-20-15-16-24(30-6)21(17-20)25(29)27(5)8-2/h7-8,10,14-17,19,26H,1,3,9,11-13H2,2,4-6H3/q+1/b14-10?,26-22+,27-8+ |
| InChIKey | DTOWFKJOZSUNDE-SKZMAYNKSA-N |
| XLogP | 4.80 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|