C16H24N2O3 — CID 162056372
(3S)-1-(3-acetyl-4-methoxyphenyl)-3,7-diaminoheptan-2-one (PubChem CID 162056372) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3S)-1-(3-acetyl-4-methoxyphenyl)-3,7-diaminoheptan-2-one.
| Compound Name | (3S)-1-(3-acetyl-4-methoxyphenyl)-3,7-diaminoheptan-2-one |
|---|---|
| PubChem CID | 162056372 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3S)-1-(3-acetyl-4-methoxyphenyl)-3,7-diaminoheptan-2-one |
| SMILES | COc1ccc(CC(=O)[C@@H](N)CCCCN)cc1C(C)=O |
| InChI | InChI=1S/C16H24N2O3/c1-11(19)13-9-12(6-7-16(13)21-2)10-15(20)14(18)5-3-4-8-17/h6-7,9,14H,3-5,8,10,17-18H2,1-2H3/t14-/m0/s1 |
| InChIKey | ZPZXLVGABIVURK-AWEZNQCLSA-N |
| XLogP | 1.47 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|