C17H24N2O4 — CID 58359558
5-[(3R)-6-(1-aminoethylideneamino)-3-methyl-2-oxohexyl]-2-methoxybenzoic acid (PubChem CID 58359558) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-[(3R)-6-(1-aminoethylideneamino)-3-methyl-2-oxohexyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(3R)-6-(1-aminoethylideneamino)-3-methyl-2-oxohexyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 58359558 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 5-[(3R)-6-(1-aminoethylideneamino)-3-methyl-2-oxohexyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(CC(=O)[C@H](C)CCC/N=C(\C)N)cc1C(=O)O |
| InChI | InChI=1S/C17H24N2O4/c1-11(5-4-8-19-12(2)18)15(20)10-13-6-7-16(23-3)14(9-13)17(21)22/h6-7,9,11H,4-5,8,10H2,1-3H3,(H2,18,19)(H,21,22)/t11-/m1/s1 |
| InChIKey | BBAMUARXSKVGRR-LLVKDONJSA-N |
| XLogP | 2.30 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|