C26H33N3O6 — CID 58239487
N-[(3S)-7-amino-1-(3-carbamoyl-4-methoxyphenyl)-2-oxoheptan-3-yl]-2-methoxy-5-(2-oxopropyl)benzamide (PubChem CID 58239487) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[(3S)-7-amino-1-(3-carbamoyl-4-methoxyphenyl)-2-oxoheptan-3-yl]-2-methoxy-5-(2-oxopropyl)benzamide.
| Compound Name | N-[(3S)-7-amino-1-(3-carbamoyl-4-methoxyphenyl)-2-oxoheptan-3-yl]-2-methoxy-5-(2-oxopropyl)benzamide |
|---|---|
| PubChem CID | 58239487 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | N-[(3S)-7-amino-1-(3-carbamoyl-4-methoxyphenyl)-2-oxoheptan-3-yl]-2-methoxy-5-(2-oxopropyl)benzamide |
| SMILES | COc1ccc(CC(=O)[C@H](CCCCN)NC(=O)c2cc(CC(C)=O)ccc2OC)cc1C(N)=O |
| InChI | InChI=1S/C26H33N3O6/c1-16(30)12-17-7-10-24(35-3)20(14-17)26(33)29-21(6-4-5-11-27)22(31)15-18-8-9-23(34-2)19(13-18)25(28)32/h7-10,13-14,21H,4-6,11-12,15,27H2,1-3H3,(H2,28,32)(H,29,33)/t21-/m0/s1 |
| InChIKey | RYGKUDIWXADBPL-NRFANRHFSA-N |
| XLogP | 1.97 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|