C47H55N3O11 — CID 58239469
2-methoxy-5-[(3S)-3-[[2-methoxy-5-[(3S)-3-methyl-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoyl]amino]-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoic acid (PubChem CID 58239469) has the molecular formula C47H55N3O11 and a molecular weight of 837.97 g/mol. Its IUPAC name is 2-methoxy-5-[(3S)-3-[[2-methoxy-5-[(3S)-3-methyl-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoyl]amino]-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoic acid.
| Compound Name | 2-methoxy-5-[(3S)-3-[[2-methoxy-5-[(3S)-3-methyl-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoyl]amino]-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoic acid |
|---|---|
| PubChem CID | 58239469 |
| Molecular Formula | C47H55N3O11 |
| Molecular Weight | 837.97 g/mol |
| Exact Mass | 837.38 |
| IUPAC Name | 2-methoxy-5-[(3S)-3-[[2-methoxy-5-[(3S)-3-methyl-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoyl]amino]-2-oxo-7-(phenylmethoxycarbonylamino)heptyl]benzoic acid |
| SMILES | COc1ccc(CC(=O)[C@H](CCCCNC(=O)OCc2ccccc2)NC(=O)c2cc(CC(=O)[C@@H](C)CCCCNC(=O)OCc3ccccc3)ccc2OC)cc1C(=O)O |
| InChI | InChI=1S/C47H55N3O11/c1-32(14-10-12-24-48-46(56)60-30-33-15-6-4-7-16-33)40(51)28-35-20-22-42(58-2)37(26-35)44(53)50-39(41(52)29-36-21-23-43(59-3)38(27-36)45(54)55)19-11-13-25-49-47(57)61-31-34-17-8-5-9-18-34/h4-9,15-18,20-23,26-27,32,39H,10-14,19,24-25,28-31H2,1-3H3,(H,48,56)(H,49,57)(H,50,53)(H,54,55)/t32-,39-/m0/s1 |
| InChIKey | SSTKDHIRBQMDHG-GSSDHLSPSA-N |
| XLogP | 7.25 |
| TPSA | 195.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.97 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|