C16H24ClNO — CID 6514878
(E)-5-(dimethylamino)-1-(3,4-dimethylphenyl)-4-methylpent-1-en-3-one;hydrochloride (PubChem CID 6514878) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is (E)-5-(dimethylamino)-1-(3,4-dimethylphenyl)-4-methylpent-1-en-3-one;hydrochloride.
| Compound Name | (E)-5-(dimethylamino)-1-(3,4-dimethylphenyl)-4-methylpent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 6514878 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (E)-5-(dimethylamino)-1-(3,4-dimethylphenyl)-4-methylpent-1-en-3-one;hydrochloride |
| SMILES | Cc1ccc(/C=C/C(=O)C(C)CN(C)C)cc1C.Cl |
| InChI | InChI=1S/C16H23NO.ClH/c1-12-6-7-15(10-13(12)2)8-9-16(18)14(3)11-17(4)5;/h6-10,14H,11H2,1-5H3;1H/b9-8+; |
| InChIKey | UZZFAFCYBPVSMC-HRNDJLQDSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|