C14H18ClNO — CID 92529470
(Z,4R)-1-(4-chlorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one (PubChem CID 92529470) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is (Z,4R)-1-(4-chlorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one.
| Compound Name | (Z,4R)-1-(4-chlorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 92529470 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (Z,4R)-1-(4-chlorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one |
| SMILES | C[C@H](CN(C)C)C(=O)/C=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO/c1-11(10-16(2)3)14(17)9-6-12-4-7-13(15)8-5-12/h4-9,11H,10H2,1-3H3/b9-6-/t11-/m1/s1 |
| InChIKey | FHFGLPJJZGSQLF-DHHDDZJSSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|