C37H43NO — CID 123418217
3-[7-[3-(5-iminocyclooctyl)phenyl]-5,6-dihydronaphthalen-2-yl]-1-(2,3,4-trimethylcyclohepta-1,3-dien-1-yl)prop-2-en-1-one (PubChem CID 123418217) has the molecular formula C37H43NO and a molecular weight of 517.76 g/mol. Its IUPAC name is 3-[7-[3-(5-iminocyclooctyl)phenyl]-5,6-dihydronaphthalen-2-yl]-1-(2,3,4-trimethylcyclohepta-1,3-dien-1-yl)prop-2-en-1-one.
| Compound Name | 3-[7-[3-(5-iminocyclooctyl)phenyl]-5,6-dihydronaphthalen-2-yl]-1-(2,3,4-trimethylcyclohepta-1,3-dien-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123418217 |
| Molecular Formula | C37H43NO |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 3-[7-[3-(5-iminocyclooctyl)phenyl]-5,6-dihydronaphthalen-2-yl]-1-(2,3,4-trimethylcyclohepta-1,3-dien-1-yl)prop-2-en-1-one |
| SMILES | [H]N=C1CCCC(c2cccc(C3=Cc4cc(C=CC(=O)C5=C(C)C(C)=C(C)CCC5)ccc4CC3)c2)CCC1 |
| InChI | InChI=1S/C37H43NO/c1-25-8-4-15-36(27(3)26(25)2)37(39)21-17-28-16-18-30-19-20-33(24-34(30)22-28)32-12-5-11-31(23-32)29-9-6-13-35(38)14-7-10-29/h5,11-12,16-18,21-24,29,38H,4,6-10,13-15,19-20H2,1-3H3/b21-17?,38-35- |
| InChIKey | BJJCWEFHZBIWFB-UTCBIQEESA-N |
| XLogP | 10.05 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|