C29H37F2NO — CID 177342765
8-[2-(1,1-difluoroethyl)-6-propan-2-ylphenyl]-3-imino-4-methylidene-1-(2,4,5-trimethylphenyl)octan-1-one (PubChem CID 177342765) has the molecular formula C29H37F2NO and a molecular weight of 453.62 g/mol. Its IUPAC name is 8-[2-(1,1-difluoroethyl)-6-propan-2-ylphenyl]-3-imino-4-methylidene-1-(2,4,5-trimethylphenyl)octan-1-one.
| Compound Name | 8-[2-(1,1-difluoroethyl)-6-propan-2-ylphenyl]-3-imino-4-methylidene-1-(2,4,5-trimethylphenyl)octan-1-one |
|---|---|
| PubChem CID | 177342765 |
| Molecular Formula | C29H37F2NO |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 8-[2-(1,1-difluoroethyl)-6-propan-2-ylphenyl]-3-imino-4-methylidene-1-(2,4,5-trimethylphenyl)octan-1-one |
| SMILES | [H]/N=C(\CC(=O)c1cc(C)c(C)cc1C)C(=C)CCCCc1c(C(C)C)cccc1C(C)(F)F |
| InChI | InChI=1S/C29H37F2NO/c1-18(2)23-13-10-14-26(29(7,30)31)24(23)12-9-8-11-19(3)27(32)17-28(33)25-16-21(5)20(4)15-22(25)6/h10,13-16,18,32H,3,8-9,11-12,17H2,1-2,4-7H3/b32-27+ |
| InChIKey | LSWWJVIYBYENGL-QVAGMWBUSA-N |
| XLogP | 8.41 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|