C33H43NO — CID 123255330
9-(cyclopentylmethyl)-2-[2-imino-2-(4-octan-4-ylphenyl)ethyl]-8,9-dihydrobenzo[7]annulen-7-one (PubChem CID 123255330) has the molecular formula C33H43NO and a molecular weight of 469.71 g/mol. Its IUPAC name is 9-(cyclopentylmethyl)-2-[2-imino-2-(4-octan-4-ylphenyl)ethyl]-8,9-dihydrobenzo[7]annulen-7-one.
| Compound Name | 9-(cyclopentylmethyl)-2-[2-imino-2-(4-octan-4-ylphenyl)ethyl]-8,9-dihydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 123255330 |
| Molecular Formula | C33H43NO |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.33 |
| IUPAC Name | 9-(cyclopentylmethyl)-2-[2-imino-2-(4-octan-4-ylphenyl)ethyl]-8,9-dihydrobenzo[7]annulen-7-one |
| SMILES | [H]/N=C(/Cc1ccc2c(c1)C(CC1CCCC1)CC(=O)C=C2)c1ccc(C(CCC)CCCC)cc1 |
| InChI | InChI=1S/C33H43NO/c1-3-5-11-26(8-4-2)27-14-16-29(17-15-27)33(34)22-25-12-13-28-18-19-31(35)23-30(32(28)21-25)20-24-9-6-7-10-24/h12-19,21,24,26,30,34H,3-11,20,22-23H2,1-2H3/b34-33- |
| InChIKey | NQDUWVWELAXENR-YHZPTAEISA-N |
| XLogP | 9.02 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|