C23H24FNO — CID 163760450
(1E)-4-ethyl-7-fluoro-1-[1-imino-1-(2-methylphenyl)butan-2-ylidene]-3,4-dihydronaphthalen-2-one (PubChem CID 163760450) has the molecular formula C23H24FNO and a molecular weight of 349.45 g/mol. Its IUPAC name is (1E)-4-ethyl-7-fluoro-1-[1-imino-1-(2-methylphenyl)butan-2-ylidene]-3,4-dihydronaphthalen-2-one.
| Compound Name | (1E)-4-ethyl-7-fluoro-1-[1-imino-1-(2-methylphenyl)butan-2-ylidene]-3,4-dihydronaphthalen-2-one |
|---|---|
| PubChem CID | 163760450 |
| Molecular Formula | C23H24FNO |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (1E)-4-ethyl-7-fluoro-1-[1-imino-1-(2-methylphenyl)butan-2-ylidene]-3,4-dihydronaphthalen-2-one |
| SMILES | [H]/N=C(C(/CC)=C1/C(=O)CC(CC)c2ccc(F)cc21)\c1ccccc1C |
| InChI | InChI=1S/C23H24FNO/c1-4-15-12-21(26)22(20-13-16(24)10-11-19(15)20)17(5-2)23(25)18-9-7-6-8-14(18)3/h6-11,13,15,25H,4-5,12H2,1-3H3/b22-17+,25-23- |
| InChIKey | LXSVYTWCFMYZSO-ZMIOFFMASA-N |
| XLogP | 5.83 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|