C22H16F3NO — CID 57039382
3-imino-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one (PubChem CID 57039382) has the molecular formula C22H16F3NO and a molecular weight of 367.37 g/mol. Its IUPAC name is 3-imino-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one.
| Compound Name | 3-imino-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57039382 |
| Molecular Formula | C22H16F3NO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-imino-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
| SMILES | [H]/N=C1\CC(c2cccc3ccccc23)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3NO/c23-22(24,25)15-8-3-7-14(11-15)20-19(26)12-18(21(20)27)17-10-4-6-13-5-1-2-9-16(13)17/h1-11,18,20,26H,12H2/b26-19+ |
| InChIKey | CADZYSDVSYYOJN-LGUFXXKBSA-N |
| XLogP | 5.72 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|