C20H18F3NO — CID 57041257
3-ethylimino-5-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one (PubChem CID 57041257) has the molecular formula C20H18F3NO and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-ethylimino-5-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one.
| Compound Name | 3-ethylimino-5-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57041257 |
| Molecular Formula | C20H18F3NO |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 3-ethylimino-5-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
| SMILES | CC/N=C1\CC(c2ccccc2)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3NO/c1-2-24-17-12-16(13-7-4-3-5-8-13)19(25)18(17)14-9-6-10-15(11-14)20(21,22)23/h3-11,16,18H,2,12H2,1H3/b24-17+ |
| InChIKey | YHQFRQURMQUUCX-JJIBRWJFSA-N |
| XLogP | 5.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|