C22H23NO3 — CID 123864994
ethyl 6-benzoyl-1-imino-3,3-dimethyl-2,4-dihydronaphthalene-2-carboxylate (PubChem CID 123864994) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 6-benzoyl-1-imino-3,3-dimethyl-2,4-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl 6-benzoyl-1-imino-3,3-dimethyl-2,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 123864994 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethyl 6-benzoyl-1-imino-3,3-dimethyl-2,4-dihydronaphthalene-2-carboxylate |
| SMILES | [H]/N=C1\c2ccc(C(=O)c3ccccc3)cc2CC(C)(C)C1C(=O)OCC |
| InChI | InChI=1S/C22H23NO3/c1-4-26-21(25)18-19(23)17-11-10-15(12-16(17)13-22(18,2)3)20(24)14-8-6-5-7-9-14/h5-12,18,23H,4,13H2,1-3H3/b23-19+ |
| InChIKey | RJHXZZAHBUMQNG-FCDQGJHFSA-N |
| XLogP | 4.05 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|