C18H23NO2 — CID 73136183
ethyl 1-iminospiro[2,4-dihydronaphthalene-3,1'-cyclohexane]-2-carboxylate (PubChem CID 73136183) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl 1-iminospiro[2,4-dihydronaphthalene-3,1'-cyclohexane]-2-carboxylate.
| Compound Name | ethyl 1-iminospiro[2,4-dihydronaphthalene-3,1'-cyclohexane]-2-carboxylate |
|---|---|
| PubChem CID | 73136183 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl 1-iminospiro[2,4-dihydronaphthalene-3,1'-cyclohexane]-2-carboxylate |
| SMILES | [H]/N=C1\c2ccccc2CC2(CCCCC2)C1C(=O)OCC |
| InChI | InChI=1S/C18H23NO2/c1-2-21-17(20)15-16(19)14-9-5-4-8-13(14)12-18(15)10-6-3-7-11-18/h4-5,8-9,15,19H,2-3,6-7,10-12H2,1H3/b19-16+ |
| InChIKey | HWVNAAULSQKECV-KNTRCKAVSA-N |
| XLogP | 3.74 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|