C21H30N2O2 — CID 138377186
methyl (1R,4aS)-9-hydrazinylidene-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 138377186) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is methyl (1R,4aS)-9-hydrazinylidene-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS)-9-hydrazinylidene-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 138377186 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | methyl (1R,4aS)-9-hydrazinylidene-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3C(=NN)CC12 |
| InChI | InChI=1S/C21H30N2O2/c1-13(2)14-7-8-16-15(11-14)17(23-22)12-18-20(16,3)9-6-10-21(18,4)19(24)25-5/h7-8,11,13,18H,6,9-10,12,22H2,1-5H3/t18?,20-,21-/m1/s1 |
| InChIKey | AUYBWDBALUDWFN-VTVVEXCCSA-N |
| XLogP | 4.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|