C16H21NO2 — CID 7071032
ethyl (2S,3R)-1-imino-3-propan-2-yl-3,4-dihydro-2H-naphthalene-2-carboxylate (PubChem CID 7071032) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl (2S,3R)-1-imino-3-propan-2-yl-3,4-dihydro-2H-naphthalene-2-carboxylate.
| Compound Name | ethyl (2S,3R)-1-imino-3-propan-2-yl-3,4-dihydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7071032 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl (2S,3R)-1-imino-3-propan-2-yl-3,4-dihydro-2H-naphthalene-2-carboxylate |
| SMILES | [H]/N=C1\c2ccccc2C[C@H](C(C)C)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C16H21NO2/c1-4-19-16(18)14-13(10(2)3)9-11-7-5-6-8-12(11)15(14)17/h5-8,10,13-14,17H,4,9H2,1-3H3/b17-15+/t13-,14+/m1/s1 |
| InChIKey | ADONWKCDIFIVKN-YIEWBZAFSA-N |
| XLogP | 3.06 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|