C21H19F2NO2 — CID 123600669
ethyl 4,6-bis(4-fluorophenyl)-2-iminocyclohex-3-ene-1-carboxylate (PubChem CID 123600669) has the molecular formula C21H19F2NO2 and a molecular weight of 355.38 g/mol. Its IUPAC name is ethyl 4,6-bis(4-fluorophenyl)-2-iminocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4,6-bis(4-fluorophenyl)-2-iminocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 123600669 |
| Molecular Formula | C21H19F2NO2 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | ethyl 4,6-bis(4-fluorophenyl)-2-iminocyclohex-3-ene-1-carboxylate |
| SMILES | [H]/N=C1\C=C(c2ccc(F)cc2)CC(c2ccc(F)cc2)C1C(=O)OCC |
| InChI | InChI=1S/C21H19F2NO2/c1-2-26-21(25)20-18(14-5-9-17(23)10-6-14)11-15(12-19(20)24)13-3-7-16(22)8-4-13/h3-10,12,18,20,24H,2,11H2,1H3/b24-19+ |
| InChIKey | BKLGXUSZZZUMCW-LYBHJNIJSA-N |
| XLogP | 4.73 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|