C19H25NO2 — CID 7315725
ethyl (2R,3R)-3-cyclohexyl-1-imino-3,4-dihydro-2H-naphthalene-2-carboxylate (PubChem CID 7315725) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl (2R,3R)-3-cyclohexyl-1-imino-3,4-dihydro-2H-naphthalene-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-cyclohexyl-1-imino-3,4-dihydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7315725 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethyl (2R,3R)-3-cyclohexyl-1-imino-3,4-dihydro-2H-naphthalene-2-carboxylate |
| SMILES | [H]/N=C1\c2ccccc2C[C@H](C2CCCCC2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C19H25NO2/c1-2-22-19(21)17-16(13-8-4-3-5-9-13)12-14-10-6-7-11-15(14)18(17)20/h6-7,10-11,13,16-17,20H,2-5,8-9,12H2,1H3/b20-18+/t16-,17-/m1/s1 |
| InChIKey | GRVNPOIMIWFKGR-ALARNLJQSA-N |
| XLogP | 3.99 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|