C9H18O3Si — CID 123723034
ethenyl-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 123723034) has the molecular formula C9H18O3Si and a molecular weight of 202.33 g/mol. Its IUPAC name is ethenyl-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | ethenyl-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 123723034 |
| Molecular Formula | C9H18O3Si |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | ethenyl-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C=C[SiH](CCCOCC1CO1)OC |
| InChI | InChI=1S/C9H18O3Si/c1-3-13(10-2)6-4-5-11-7-9-8-12-9/h3,9,13H,1,4-8H2,2H3 |
| InChIKey | ZISOMZAZNSVXBR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|