C16H29NO — CID 123723780
4-cyclopentyl-2-ethylidene-N,N,5-trimethylhexanamide (PubChem CID 123723780) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 4-cyclopentyl-2-ethylidene-N,N,5-trimethylhexanamide.
| Compound Name | 4-cyclopentyl-2-ethylidene-N,N,5-trimethylhexanamide |
|---|---|
| PubChem CID | 123723780 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 4-cyclopentyl-2-ethylidene-N,N,5-trimethylhexanamide |
| SMILES | CC=C(CC(C(C)C)C1CCCC1)C(=O)N(C)C |
| InChI | InChI=1S/C16H29NO/c1-6-13(16(18)17(4)5)11-15(12(2)3)14-9-7-8-10-14/h6,12,14-15H,7-11H2,1-5H3 |
| InChIKey | ASECRGGFBAVHPR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|