C25H22BrN5O3S — CID 123724560
1-benzyl-N-[5-bromo-1-(4-methylphenyl)sulfonyl-5,6-dihydropyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide (PubChem CID 123724560) has the molecular formula C25H22BrN5O3S and a molecular weight of 552.45 g/mol. Its IUPAC name is 1-benzyl-N-[5-bromo-1-(4-methylphenyl)sulfonyl-5,6-dihydropyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[5-bromo-1-(4-methylphenyl)sulfonyl-5,6-dihydropyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123724560 |
| Molecular Formula | C25H22BrN5O3S |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 1-benzyl-N-[5-bromo-1-(4-methylphenyl)sulfonyl-5,6-dihydropyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(NC(=O)c3cnn(Cc4ccccc4)c3)c3c2=NCC(Br)C=3)cc1 |
| InChI | InChI=1S/C25H22BrN5O3S/c1-17-7-9-21(10-8-17)35(33,34)31-16-23(22-11-20(26)13-27-24(22)31)29-25(32)19-12-28-30(15-19)14-18-5-3-2-4-6-18/h2-12,15-16,20H,13-14H2,1H3,(H,29,32) |
| InChIKey | QTVJWEWUIQLOQY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|