C31H32BN5O5S — CID 123169593
1-benzyl-N-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide (PubChem CID 123169593) has the molecular formula C31H32BN5O5S and a molecular weight of 597.51 g/mol. Its IUPAC name is 1-benzyl-N-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123169593 |
| Molecular Formula | C31H32BN5O5S |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 1-benzyl-N-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(NC(=O)c3cnn(Cc4ccccc4)c3)c3cc(B4OC(C)(C)C(C)(C)O4)cnc32)cc1 |
| InChI | InChI=1S/C31H32BN5O5S/c1-21-11-13-25(14-12-21)43(39,40)37-20-27(35-29(38)23-16-34-36(19-23)18-22-9-7-6-8-10-22)26-15-24(17-33-28(26)37)32-41-30(2,3)31(4,5)42-32/h6-17,19-20H,18H2,1-5H3,(H,35,38) |
| InChIKey | RLIKCTSDMAQFES-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|