C30H33BN4O6S2 — CID 71055218
1-(4-methylphenyl)sulfonyl-3-[2-(4-methylphenyl)sulfonyl-1,5-dihydropyrazol-3-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 71055218) has the molecular formula C30H33BN4O6S2 and a molecular weight of 620.56 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-[2-(4-methylphenyl)sulfonyl-1,5-dihydropyrazol-3-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-[2-(4-methylphenyl)sulfonyl-1,5-dihydropyrazol-3-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71055218 |
| Molecular Formula | C30H33BN4O6S2 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-[2-(4-methylphenyl)sulfonyl-1,5-dihydropyrazol-3-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2NCC=C2c2cn(S(=O)(=O)c3ccc(C)cc3)c3ncc(B4OC(C)(C)C(C)(C)O4)cc23)cc1 |
| InChI | InChI=1S/C30H33BN4O6S2/c1-20-7-11-23(12-8-20)42(36,37)34-19-26(27-15-16-33-35(27)43(38,39)24-13-9-21(2)10-14-24)25-17-22(18-32-28(25)34)31-40-29(3,4)30(5,6)41-31/h7-15,17-19,33H,16H2,1-6H3 |
| InChIKey | RMACLNCXVOAGOC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|