C20H22BN3O6S — CID 123135452
1-(4-methylphenyl)sulfonyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 123135452) has the molecular formula C20H22BN3O6S and a molecular weight of 443.29 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123135452 |
| Molecular Formula | C20H22BN3O6S |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(B3OC(C)(C)C(C)(C)O3)c3cc([N+](=O)[O-])cnc32)cc1 |
| InChI | InChI=1S/C20H22BN3O6S/c1-13-6-8-15(9-7-13)31(27,28)23-12-17(21-29-19(2,3)20(4,5)30-21)16-10-14(24(25)26)11-22-18(16)23/h6-12H,1-5H3 |
| InChIKey | REJCWPPKVCVXIB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|