C21H25BN2O5S — CID 123135650
7-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine (PubChem CID 123135650) has the molecular formula C21H25BN2O5S and a molecular weight of 428.32 g/mol. Its IUPAC name is 7-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 7-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 123135650 |
| Molecular Formula | C21H25BN2O5S |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 7-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[3,2-b]pyridine |
| SMILES | COc1ccnc2c(B3OC(C)(C)C(C)(C)O3)cn(S(=O)(=O)c3ccc(C)cc3)c12 |
| InChI | InChI=1S/C21H25BN2O5S/c1-14-7-9-15(10-8-14)30(25,26)24-13-16(18-19(24)17(27-6)11-12-23-18)22-28-20(2,3)21(4,5)29-22/h7-13H,1-6H3 |
| InChIKey | ZIRDHLLRQMBQKC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|