C21H26BFN2O5S — CID 70821997
5-fluoro-4-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyrrolo[2,3-b]pyridine (PubChem CID 70821997) has the molecular formula C21H26BFN2O5S and a molecular weight of 448.33 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 5-fluoro-4-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70821997 |
| Molecular Formula | C21H26BFN2O5S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 5-fluoro-4-methoxy-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyrrolo[2,3-b]pyridine |
| SMILES | COC1=c2c(B3OC(C)(C)C(C)(C)O3)cn(S(=O)(=O)c3ccc(C)cc3)c2=NCC1F |
| InChI | InChI=1S/C21H26BFN2O5S/c1-13-7-9-14(10-8-13)31(26,27)25-12-15(22-29-20(2,3)21(4,5)30-22)17-18(28-6)16(23)11-24-19(17)25/h7-10,12,16H,11H2,1-6H3 |
| InChIKey | CLXZWSBPBMQALW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|