C28H31BN4O5S — CID 163283105
N,N-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide (PubChem CID 163283105) has the molecular formula C28H31BN4O5S and a molecular weight of 546.46 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide.
| Compound Name | N,N-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide |
|---|---|
| PubChem CID | 163283105 |
| Molecular Formula | C28H31BN4O5S |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N,N-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc(C(=O)N(C)C)cc3)c3nc(B4OC(C)(C)C(C)(C)O4)cnc32)cc1 |
| InChI | InChI=1S/C28H31BN4O5S/c1-18-8-14-21(15-9-18)39(35,36)33-17-22(19-10-12-20(13-11-19)26(34)32(6)7)24-25(33)30-16-23(31-24)29-37-27(2,3)28(4,5)38-29/h8-17H,1-7H3 |
| InChIKey | DJAVCHBMYQQWRD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|