C16H19N — CID 123724785
3-(3,4-dimethylphenyl)-N,2-dimethylaniline (PubChem CID 123724785) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N,2-dimethylaniline.
| Compound Name | 3-(3,4-dimethylphenyl)-N,2-dimethylaniline |
|---|---|
| PubChem CID | 123724785 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N,2-dimethylaniline |
| SMILES | CNc1cccc(-c2ccc(C)c(C)c2)c1C |
| InChI | InChI=1S/C16H19N/c1-11-8-9-14(10-12(11)2)15-6-5-7-16(17-4)13(15)3/h5-10,17H,1-4H3 |
| InChIKey | VJWFOYVDHDDBGO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |