C18H20FN7O — CID 123726192
amino-[3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1H-pyrazol-5-yl]methanol (PubChem CID 123726192) has the molecular formula C18H20FN7O and a molecular weight of 369.40 g/mol. Its IUPAC name is amino-[3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1H-pyrazol-5-yl]methanol.
| Compound Name | amino-[3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1H-pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 123726192 |
| Molecular Formula | C18H20FN7O |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | amino-[3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1H-pyrazol-5-yl]methanol |
| SMILES | NC(O)c1cc(-c2ccc(NCC3(c4ncccc4F)CCC3)nn2)n[nH]1 |
| InChI | InChI=1S/C18H20FN7O/c19-11-3-1-8-21-16(11)18(6-2-7-18)10-22-15-5-4-12(23-26-15)13-9-14(17(20)27)25-24-13/h1,3-5,8-9,17,27H,2,6-7,10,20H2,(H,22,26)(H,24,25) |
| InChIKey | MNSGBNUQUKKMLG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|