C18H19FN6O2 — CID 131981877
amino-[5-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1,2-oxazol-3-yl]methanol (PubChem CID 131981877) has the molecular formula C18H19FN6O2 and a molecular weight of 370.39 g/mol. Its IUPAC name is amino-[5-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1,2-oxazol-3-yl]methanol.
| Compound Name | amino-[5-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 131981877 |
| Molecular Formula | C18H19FN6O2 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | amino-[5-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methylamino]pyridazin-3-yl]-1,2-oxazol-3-yl]methanol |
| SMILES | NC(O)c1cc(-c2ccc(NCC3(c4ncccc4F)CCC3)nn2)on1 |
| InChI | InChI=1S/C18H19FN6O2/c19-11-3-1-8-21-16(11)18(6-2-7-18)10-22-15-5-4-12(23-24-15)14-9-13(17(20)26)25-27-14/h1,3-5,8-9,17,26H,2,6-7,10,20H2,(H,22,24) |
| InChIKey | DAMYXTLYLQYQAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|