C23H25FN6 — CID 123726198
6-[5-[4-(aminomethyl)piperidin-1-yl]-3-pyridinyl]-4-(2-fluorobenzenecarboximidoyl)pyridin-3-amine (PubChem CID 123726198) has the molecular formula C23H25FN6 and a molecular weight of 404.49 g/mol. Its IUPAC name is 6-[5-[4-(aminomethyl)piperidin-1-yl]-3-pyridinyl]-4-(2-fluorobenzenecarboximidoyl)pyridin-3-amine.
| Compound Name | 6-[5-[4-(aminomethyl)piperidin-1-yl]-3-pyridinyl]-4-(2-fluorobenzenecarboximidoyl)pyridin-3-amine |
|---|---|
| PubChem CID | 123726198 |
| Molecular Formula | C23H25FN6 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 6-[5-[4-(aminomethyl)piperidin-1-yl]-3-pyridinyl]-4-(2-fluorobenzenecarboximidoyl)pyridin-3-amine |
| SMILES | [H]/N=C(/c1cc(-c2cncc(N3CCC(CN)CC3)c2)ncc1N)c1ccccc1F |
| InChI | InChI=1S/C23H25FN6/c24-20-4-2-1-3-18(20)23(27)19-10-22(29-14-21(19)26)16-9-17(13-28-12-16)30-7-5-15(11-25)6-8-30/h1-4,9-10,12-15,27H,5-8,11,25-26H2/b27-23+ |
| InChIKey | NPLHSKAYBKZTGT-SLEBQGDGSA-N |
| XLogP | 3.46 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|