C19H28N4O2S — CID 123726625
2-[12-[[4-(dimethylamino)cyclohexyl]amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]ethane-1,1-diol (PubChem CID 123726625) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 2-[12-[[4-(dimethylamino)cyclohexyl]amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]ethane-1,1-diol.
| Compound Name | 2-[12-[[4-(dimethylamino)cyclohexyl]amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 123726625 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[12-[[4-(dimethylamino)cyclohexyl]amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]ethane-1,1-diol |
| SMILES | CN(C)C1CCC(Nc2ncnc3sc4c(c23)C(CC(O)O)CC4)CC1 |
| InChI | InChI=1S/C19H28N4O2S/c1-23(2)13-6-4-12(5-7-13)22-18-17-16-11(9-15(24)25)3-8-14(16)26-19(17)21-10-20-18/h10-13,15,24-25H,3-9H2,1-2H3,(H,20,21,22) |
| InChIKey | ICUSFUOUTOSZEB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|