C20H28N4O2S — CID 86695264
[(3S)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]methanol (PubChem CID 86695264) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is [(3S)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]methanol.
| Compound Name | [(3S)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]methanol |
|---|---|
| PubChem CID | 86695264 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(3S)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]methanol |
| SMILES | OC[C@H]1CCc2sc3ncnc(NC4CCC(N5CCOCC5)CC4)c3c21 |
| InChI | InChI=1S/C20H28N4O2S/c25-11-13-1-6-16-17(13)18-19(21-12-22-20(18)27-16)23-14-2-4-15(5-3-14)24-7-9-26-10-8-24/h12-15,25H,1-11H2,(H,21,22,23)/t13-,14?,15?/m1/s1 |
| InChIKey | VKPSKYSZMONOKS-WLYUNCDWSA-N |
| XLogP | 2.77 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |