C11H22F2N2O2 — CID 123726990
1-(3,3-difluoropyrrolidin-1-yl)-2-(methoxymethylamino)-3-methylbutan-1-ol (PubChem CID 123726990) has the molecular formula C11H22F2N2O2 and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(3,3-difluoropyrrolidin-1-yl)-2-(methoxymethylamino)-3-methylbutan-1-ol.
| Compound Name | 1-(3,3-difluoropyrrolidin-1-yl)-2-(methoxymethylamino)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 123726990 |
| Molecular Formula | C11H22F2N2O2 |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-(3,3-difluoropyrrolidin-1-yl)-2-(methoxymethylamino)-3-methylbutan-1-ol |
| SMILES | COCNC(C(C)C)C(O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H22F2N2O2/c1-8(2)9(14-7-17-3)10(16)15-5-4-11(12,13)6-15/h8-10,14,16H,4-7H2,1-3H3 |
| InChIKey | BCRNCLITSOQTNG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|