C18H18BCl2N2O2 — CID 123727796
CID 123727796 (PubChem CID 123727796) has the molecular formula C18H18BCl2N2O2 and a molecular weight of 376.07 g/mol.
| Compound Name | CID 123727796 |
|---|---|
| PubChem CID | 123727796 |
| Molecular Formula | C18H18BCl2N2O2 |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cccc(Cl)c1)C1NC([B]CO)CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18BCl2N2O2/c20-12-4-1-3-11(7-12)15-9-16(19-10-24)23-17(15)18(25)22-14-6-2-5-13(21)8-14/h1-8,15-17,23-24H,9-10H2,(H,22,25) |
| InChIKey | WOJMDFOZYFWANS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|