C22H26Cl2N2O — CID 138744601
N,4-bis(3-chlorophenyl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carboxamide (PubChem CID 138744601) has the molecular formula C22H26Cl2N2O and a molecular weight of 405.37 g/mol. Its IUPAC name is N,4-bis(3-chlorophenyl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | N,4-bis(3-chlorophenyl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 138744601 |
| Molecular Formula | C22H26Cl2N2O |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N,4-bis(3-chlorophenyl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)CC1NCC(c2cccc(Cl)c2)C1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26Cl2N2O/c1-22(2,3)12-19-20(21(27)26-17-9-5-8-16(24)11-17)18(13-25-19)14-6-4-7-15(23)10-14/h4-11,18-20,25H,12-13H2,1-3H3,(H,26,27) |
| InChIKey | ZIPDDWOCVUWCOV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |