C27H28Cl2N2O3 — CID 143819886
(2S,4R)-N,4-bis(3-chlorophenyl)-2-(2-hydroxy-5-methylphenyl)-6-oxopiperidine-3-carboxamide;ethane (PubChem CID 143819886) has the molecular formula C27H28Cl2N2O3 and a molecular weight of 499.44 g/mol. Its IUPAC name is (2S,4R)-N,4-bis(3-chlorophenyl)-2-(2-hydroxy-5-methylphenyl)-6-oxopiperidine-3-carboxamide;ethane.
| Compound Name | (2S,4R)-N,4-bis(3-chlorophenyl)-2-(2-hydroxy-5-methylphenyl)-6-oxopiperidine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143819886 |
| Molecular Formula | C27H28Cl2N2O3 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (2S,4R)-N,4-bis(3-chlorophenyl)-2-(2-hydroxy-5-methylphenyl)-6-oxopiperidine-3-carboxamide;ethane |
| SMILES | CC.Cc1ccc(O)c([C@H]2NC(=O)C[C@@H](c3cccc(Cl)c3)C2C(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C25H22Cl2N2O3.C2H6/c1-14-8-9-21(30)20(10-14)24-23(25(32)28-18-7-3-6-17(27)12-18)19(13-22(31)29-24)15-4-2-5-16(26)11-15;1-2/h2-12,19,23-24,30H,13H2,1H3,(H,28,32)(H,29,31);1-2H3/t19-,23?,24+;/m0./s1 |
| InChIKey | UUIXBGUYAKENCG-FMGHLJLYSA-N |
| XLogP | 6.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|