C25H24Cl2N2O2 — CID 143538627
chlorobenzene;(2S)-N-(3-chlorophenyl)-2-(3-methylphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 143538627) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is chlorobenzene;(2S)-N-(3-chlorophenyl)-2-(3-methylphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | chlorobenzene;(2S)-N-(3-chlorophenyl)-2-(3-methylphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 143538627 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | chlorobenzene;(2S)-N-(3-chlorophenyl)-2-(3-methylphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1cccc(C2NC(=O)CCC2C(=O)Nc2cccc(Cl)c2)c1.Clc1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O2.C6H5Cl/c1-12-4-2-5-13(10-12)18-16(8-9-17(23)22-18)19(24)21-15-7-3-6-14(20)11-15;7-6-4-2-1-3-5-6/h2-7,10-11,16,18H,8-9H2,1H3,(H,21,24)(H,22,23);1-5H |
| InChIKey | PYYUQPRYYHYFDV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |